C28H23FO7 — CID 134467370
[2-fluoro-4-(4-methoxyphenyl)phenyl] 3-[3,4-di(prop-2-enoyloxy)phenyl]propanoate (PubChem CID 134467370) has the molecular formula C28H23FO7 and a molecular weight of 490.48 g/mol. Its IUPAC name is [2-fluoro-4-(4-methoxyphenyl)phenyl] 3-[3,4-di(prop-2-enoyloxy)phenyl]propanoate.
| Compound Name | [2-fluoro-4-(4-methoxyphenyl)phenyl] 3-[3,4-di(prop-2-enoyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 134467370 |
| Molecular Formula | C28H23FO7 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [2-fluoro-4-(4-methoxyphenyl)phenyl] 3-[3,4-di(prop-2-enoyloxy)phenyl]propanoate |
| SMILES | C=CC(=O)Oc1ccc(CCC(=O)Oc2ccc(-c3ccc(OC)cc3)cc2F)cc1OC(=O)C=C |
| InChI | InChI=1S/C28H23FO7/c1-4-26(30)35-24-13-6-18(16-25(24)36-27(31)5-2)7-15-28(32)34-23-14-10-20(17-22(23)29)19-8-11-21(33-3)12-9-19/h4-6,8-14,16-17H,1-2,7,15H2,3H3 |
| InChIKey | XGYVDWPTGQZMPO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|