C38H31FO8 — CID 129172169
[4-[2-fluoro-4-[4-[3-[4-(2-formylprop-2-enoxy)-3-prop-2-enoyloxyphenyl]propanoyloxy]phenyl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 129172169) has the molecular formula C38H31FO8 and a molecular weight of 634.66 g/mol. Its IUPAC name is [4-[2-fluoro-4-[4-[3-[4-(2-formylprop-2-enoxy)-3-prop-2-enoyloxyphenyl]propanoyloxy]phenyl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-fluoro-4-[4-[3-[4-(2-formylprop-2-enoxy)-3-prop-2-enoyloxyphenyl]propanoyloxy]phenyl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129172169 |
| Molecular Formula | C38H31FO8 |
| Molecular Weight | 634.66 g/mol |
| Exact Mass | 634.20 |
| IUPAC Name | [4-[2-fluoro-4-[4-[3-[4-(2-formylprop-2-enoxy)-3-prop-2-enoyloxyphenyl]propanoyloxy]phenyl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(CCC(=O)Oc2ccc(-c3ccc(-c4ccc(OC(=O)C(=C)C)cc4)c(F)c3)cc2)ccc1OCC(=C)C=O |
| InChI | InChI=1S/C38H31FO8/c1-5-36(41)47-35-20-26(6-18-34(35)44-23-25(4)22-40)7-19-37(42)45-30-13-8-27(9-14-30)29-12-17-32(33(39)21-29)28-10-15-31(16-11-28)46-38(43)24(2)3/h5-6,8-18,20-22H,1-2,4,7,19,23H2,3H3 |
| InChIKey | UDRLLWFMYWCMOJ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.66 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|