C46H44F2O6 — CID 144959744
[4-[3-fluoro-4-[3-fluoro-4-[(3Z)-2-methylocta-1,3-dien-3-yl]oxyphenyl]phenyl]phenyl] 3-[3-(1-cyclobutylideneprop-2-enoxy)-4-prop-2-enoyloxyphenyl]propanoate (PubChem CID 144959744) has the molecular formula C46H44F2O6 and a molecular weight of 730.85 g/mol. Its IUPAC name is [4-[3-fluoro-4-[3-fluoro-4-[(3Z)-2-methylocta-1,3-dien-3-yl]oxyphenyl]phenyl]phenyl] 3-[3-(1-cyclobutylideneprop-2-enoxy)-4-prop-2-enoyloxyphenyl]propanoate.
| Compound Name | [4-[3-fluoro-4-[3-fluoro-4-[(3Z)-2-methylocta-1,3-dien-3-yl]oxyphenyl]phenyl]phenyl] 3-[3-(1-cyclobutylideneprop-2-enoxy)-4-prop-2-enoyloxyphenyl]propanoate |
|---|---|
| PubChem CID | 144959744 |
| Molecular Formula | C46H44F2O6 |
| Molecular Weight | 730.85 g/mol |
| Exact Mass | 730.31 |
| IUPAC Name | [4-[3-fluoro-4-[3-fluoro-4-[(3Z)-2-methylocta-1,3-dien-3-yl]oxyphenyl]phenyl]phenyl] 3-[3-(1-cyclobutylideneprop-2-enoxy)-4-prop-2-enoyloxyphenyl]propanoate |
| SMILES | C=CC(=O)Oc1ccc(CCC(=O)Oc2ccc(-c3ccc(-c4ccc(O/C(=C\CCCC)C(=C)C)c(F)c4)c(F)c3)cc2)cc1OC(C=C)=C1CCC1 |
| InChI | InChI=1S/C46H44F2O6/c1-6-9-10-14-41(30(4)5)53-42-25-20-35(29-39(42)48)37-23-19-34(28-38(37)47)32-17-21-36(22-18-32)51-46(50)26-16-31-15-24-43(54-45(49)8-3)44(27-31)52-40(7-2)33-12-11-13-33/h7-8,14-15,17-25,27-29H,2-4,6,9-13,16,26H2,1,5H3/b41-14- |
| InChIKey | HXYRLMZCVZYMKA-QVGWBTEESA-N |
| XLogP | 11.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.85 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|