C29H29FO3 — CID 22630261
[2-fluoro-4-[2-(7-pentoxy-9H-fluoren-2-yl)ethyl]phenyl] prop-2-enoate (PubChem CID 22630261) has the molecular formula C29H29FO3 and a molecular weight of 444.55 g/mol. Its IUPAC name is [2-fluoro-4-[2-(7-pentoxy-9H-fluoren-2-yl)ethyl]phenyl] prop-2-enoate.
| Compound Name | [2-fluoro-4-[2-(7-pentoxy-9H-fluoren-2-yl)ethyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 22630261 |
| Molecular Formula | C29H29FO3 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | [2-fluoro-4-[2-(7-pentoxy-9H-fluoren-2-yl)ethyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(CCc2ccc3c(c2)Cc2cc(OCCCCC)ccc2-3)cc1F |
| InChI | InChI=1S/C29H29FO3/c1-3-5-6-15-32-24-11-13-26-23(19-24)18-22-16-20(9-12-25(22)26)7-8-21-10-14-28(27(30)17-21)33-29(31)4-2/h4,9-14,16-17,19H,2-3,5-8,15,18H2,1H3 |
| InChIKey | JVPLWHFMBHUSJR-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|