C27H24N2O3 — CID 23527462
[2-[2-(7-pentoxy-9H-fluoren-2-yl)ethynyl]pyrimidin-5-yl] prop-2-enoate (PubChem CID 23527462) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is [2-[2-(7-pentoxy-9H-fluoren-2-yl)ethynyl]pyrimidin-5-yl] prop-2-enoate.
| Compound Name | [2-[2-(7-pentoxy-9H-fluoren-2-yl)ethynyl]pyrimidin-5-yl] prop-2-enoate |
|---|---|
| PubChem CID | 23527462 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [2-[2-(7-pentoxy-9H-fluoren-2-yl)ethynyl]pyrimidin-5-yl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cnc(C#Cc2ccc3c(c2)Cc2cc(OCCCCC)ccc2-3)nc1 |
| InChI | InChI=1S/C27H24N2O3/c1-3-5-6-13-31-22-9-11-25-21(16-22)15-20-14-19(7-10-24(20)25)8-12-26-28-17-23(18-29-26)32-27(30)4-2/h4,7,9-11,14,16-18H,2-3,5-6,13,15H2,1H3 |
| InChIKey | VDARJRZNIRYAER-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|