C28H25F3O4 — CID 23527506
[4-[difluoro-[(7-pentoxy-9H-fluoren-2-yl)oxy]methyl]-2-fluorophenyl] prop-2-enoate (PubChem CID 23527506) has the molecular formula C28H25F3O4 and a molecular weight of 482.50 g/mol. Its IUPAC name is [4-[difluoro-[(7-pentoxy-9H-fluoren-2-yl)oxy]methyl]-2-fluorophenyl] prop-2-enoate.
| Compound Name | [4-[difluoro-[(7-pentoxy-9H-fluoren-2-yl)oxy]methyl]-2-fluorophenyl] prop-2-enoate |
|---|---|
| PubChem CID | 23527506 |
| Molecular Formula | C28H25F3O4 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [4-[difluoro-[(7-pentoxy-9H-fluoren-2-yl)oxy]methyl]-2-fluorophenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C(F)(F)Oc2ccc3c(c2)Cc2cc(OCCCCC)ccc2-3)cc1F |
| InChI | InChI=1S/C28H25F3O4/c1-3-5-6-13-33-21-8-10-23-18(15-21)14-19-16-22(9-11-24(19)23)35-28(30,31)20-7-12-26(25(29)17-20)34-27(32)4-2/h4,7-12,15-17H,2-3,5-6,13-14H2,1H3 |
| InChIKey | QYYPDHIQVPSWHP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|