C19H19F3O2 — CID 18377936
2-butoxy-7-(trifluoromethoxy)-9,10-dihydrophenanthrene (PubChem CID 18377936) has the molecular formula C19H19F3O2 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-butoxy-7-(trifluoromethoxy)-9,10-dihydrophenanthrene.
| Compound Name | 2-butoxy-7-(trifluoromethoxy)-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 18377936 |
| Molecular Formula | C19H19F3O2 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-butoxy-7-(trifluoromethoxy)-9,10-dihydrophenanthrene |
| SMILES | CCCCOc1ccc2c(c1)CCc1cc(OC(F)(F)F)ccc1-2 |
| InChI | InChI=1S/C19H19F3O2/c1-2-3-10-23-15-6-8-17-13(11-15)4-5-14-12-16(7-9-18(14)17)24-19(20,21)22/h6-9,11-12H,2-5,10H2,1H3 |
| InChIKey | UAALQAYXTRKCBM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|