C10H7F3O2 — CID 22119026
5-(trifluoromethoxy)-2,3-dihydroinden-1-one (PubChem CID 22119026) has the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. Its IUPAC name is 5-(trifluoromethoxy)-2,3-dihydroinden-1-one.
| Compound Name | 5-(trifluoromethoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 22119026 |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 5-(trifluoromethoxy)-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C10H7F3O2/c11-10(12,13)15-7-2-3-8-6(5-7)1-4-9(8)14/h2-3,5H,1,4H2 |
| InChIKey | DJGOAKVCWWDUHQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |