C13H16O3 — CID 104985826
5-(2-hydroxy-2-methylpropoxy)-2,3-dihydroinden-1-one (PubChem CID 104985826) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 5-(2-hydroxy-2-methylpropoxy)-2,3-dihydroinden-1-one.
| Compound Name | 5-(2-hydroxy-2-methylpropoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 104985826 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 5-(2-hydroxy-2-methylpropoxy)-2,3-dihydroinden-1-one |
| SMILES | CC(C)(O)COc1ccc2c(c1)CCC2=O |
| InChI | InChI=1S/C13H16O3/c1-13(2,15)8-16-10-4-5-11-9(7-10)3-6-12(11)14/h4-5,7,15H,3,6,8H2,1-2H3 |
| InChIKey | OTVUCIBCAMGCBL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |