C15H20O2 — CID 107684058
5-(2-methylpentoxy)-2,3-dihydroinden-1-one (PubChem CID 107684058) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 5-(2-methylpentoxy)-2,3-dihydroinden-1-one.
| Compound Name | 5-(2-methylpentoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 107684058 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 5-(2-methylpentoxy)-2,3-dihydroinden-1-one |
| SMILES | CCCC(C)COc1ccc2c(c1)CCC2=O |
| InChI | InChI=1S/C15H20O2/c1-3-4-11(2)10-17-13-6-7-14-12(9-13)5-8-15(14)16/h6-7,9,11H,3-5,8,10H2,1-2H3 |
| InChIKey | MBJXGIFGJAIOGY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |