C16H24O2 — CID 114091344
7-(2-methylpentoxy)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 114091344) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 7-(2-methylpentoxy)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 7-(2-methylpentoxy)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 114091344 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 7-(2-methylpentoxy)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | CCCC(C)COc1ccc2c(c1)C(O)CCC2 |
| InChI | InChI=1S/C16H24O2/c1-3-5-12(2)11-18-14-9-8-13-6-4-7-16(17)15(13)10-14/h8-10,12,16-17H,3-7,11H2,1-2H3 |
| InChIKey | SHYDQTDCMCPZLE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |