C14H18O2 — CID 104986088
5-pentoxy-2,3-dihydroinden-1-one (PubChem CID 104986088) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-pentoxy-2,3-dihydroinden-1-one.
| Compound Name | 5-pentoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 104986088 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 5-pentoxy-2,3-dihydroinden-1-one |
| SMILES | CCCCCOc1ccc2c(c1)CCC2=O |
| InChI | InChI=1S/C14H18O2/c1-2-3-4-9-16-12-6-7-13-11(10-12)5-8-14(13)15/h6-7,10H,2-5,8-9H2,1H3 |
| InChIKey | PZUYASGLZQXOGG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|