C19H22O — CID 143490734
2-pentoxy-9,10-dihydrophenanthrene (PubChem CID 143490734) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-pentoxy-9,10-dihydrophenanthrene.
| Compound Name | 2-pentoxy-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 143490734 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-pentoxy-9,10-dihydrophenanthrene |
| SMILES | CCCCCOc1ccc2c(c1)CCc1ccccc1-2 |
| InChI | InChI=1S/C19H22O/c1-2-3-6-13-20-17-11-12-19-16(14-17)10-9-15-7-4-5-8-18(15)19/h4-5,7-8,11-12,14H,2-3,6,9-10,13H2,1H3 |
| InChIKey | PLTSUMYEHOJSHT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|