C38H44N2O2 — CID 142316272
6,19-diheptoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile (PubChem CID 142316272) has the molecular formula C38H44N2O2 and a molecular weight of 560.78 g/mol. Its IUPAC name is 6,19-diheptoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile.
| Compound Name | 6,19-diheptoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile |
|---|---|
| PubChem CID | 142316272 |
| Molecular Formula | C38H44N2O2 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | 6,19-diheptoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile |
| SMILES | CCCCCCCOc1ccc2c(c1)CCc1c(C#N)c(C#N)c3c(c1-2)-c1ccc(OCCCCCCC)cc1CC3 |
| InChI | InChI=1S/C38H44N2O2/c1-3-5-7-9-11-21-41-29-15-19-31-27(23-29)13-17-33-35(25-39)36(26-40)34-18-14-28-24-30(42-22-12-10-8-6-4-2)16-20-32(28)38(34)37(31)33/h15-16,19-20,23-24H,3-14,17-18,21-22H2,1-2H3 |
| InChIKey | OTEDSFRNHWIEHJ-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|