C36H36N2O4 — CID 134400794
6,19-bis(6-oxohexoxy)pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile (PubChem CID 134400794) has the molecular formula C36H36N2O4 and a molecular weight of 560.69 g/mol. Its IUPAC name is 6,19-bis(6-oxohexoxy)pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile.
| Compound Name | 6,19-bis(6-oxohexoxy)pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile |
|---|---|
| PubChem CID | 134400794 |
| Molecular Formula | C36H36N2O4 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 6,19-bis(6-oxohexoxy)pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c2c(c3c1CCc1cc(OCCCCCC=O)ccc1-3)-c1ccc(OCCCCCC=O)cc1CC2 |
| InChI | InChI=1S/C36H36N2O4/c37-23-33-31-13-9-25-21-27(41-19-7-3-1-5-17-39)11-15-29(25)35(31)36-30-16-12-28(42-20-8-4-2-6-18-40)22-26(30)10-14-32(36)34(33)24-38/h11-12,15-18,21-22H,1-10,13-14,19-20H2 |
| InChIKey | USNHBFADEGTAKK-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|