C12H10N2O2 — CID 176714940
5-(4-oxobutoxy)benzene-1,3-dicarbonitrile (PubChem CID 176714940) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 5-(4-oxobutoxy)benzene-1,3-dicarbonitrile.
| Compound Name | 5-(4-oxobutoxy)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 176714940 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 5-(4-oxobutoxy)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(OCCCC=O)c1 |
| InChI | InChI=1S/C12H10N2O2/c13-8-10-5-11(9-14)7-12(6-10)16-4-2-1-3-15/h3,5-7H,1-2,4H2 |
| InChIKey | KRYUBOPIRONFDK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|