C12H13NO2 — CID 65470226
3,5-dimethyl-4-(3-oxopropoxy)benzonitrile (PubChem CID 65470226) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3,5-dimethyl-4-(3-oxopropoxy)benzonitrile.
| Compound Name | 3,5-dimethyl-4-(3-oxopropoxy)benzonitrile |
|---|---|
| PubChem CID | 65470226 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3,5-dimethyl-4-(3-oxopropoxy)benzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1OCCC=O |
| InChI | InChI=1S/C12H13NO2/c1-9-6-11(8-13)7-10(2)12(9)15-5-3-4-14/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | CAKMRFQLKIUAAV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|