C14H19NO3S — CID 106724797
3,5-dimethyl-4-(2-propan-2-ylsulfonylethoxy)benzonitrile (PubChem CID 106724797) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3,5-dimethyl-4-(2-propan-2-ylsulfonylethoxy)benzonitrile.
| Compound Name | 3,5-dimethyl-4-(2-propan-2-ylsulfonylethoxy)benzonitrile |
|---|---|
| PubChem CID | 106724797 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3,5-dimethyl-4-(2-propan-2-ylsulfonylethoxy)benzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1OCCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C14H19NO3S/c1-10(2)19(16,17)6-5-18-14-11(3)7-13(9-15)8-12(14)4/h7-8,10H,5-6H2,1-4H3 |
| InChIKey | IMOOMCWQQTYHBE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |