C13H18N2O2 — CID 103482555
4-[2-(2-aminoethoxy)ethoxy]-3,5-dimethylbenzonitrile (PubChem CID 103482555) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-[2-(2-aminoethoxy)ethoxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[2-(2-aminoethoxy)ethoxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 103482555 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-[2-(2-aminoethoxy)ethoxy]-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1OCCOCCN |
| InChI | InChI=1S/C13H18N2O2/c1-10-7-12(9-15)8-11(2)13(10)17-6-5-16-4-3-14/h7-8H,3-6,14H2,1-2H3 |
| InChIKey | UBKPPSJWYUXIBN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|