C10H10BF3KNO — CID 65470810
potassium (4-cyano-2,6-dimethylphenoxy)methyl-trifluoroboranuide (PubChem CID 65470810) has the molecular formula C10H10BF3KNO and a molecular weight of 267.10 g/mol. Its IUPAC name is potassium (4-cyano-2,6-dimethylphenoxy)methyl-trifluoroboranuide.
| Compound Name | potassium (4-cyano-2,6-dimethylphenoxy)methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 65470810 |
| Molecular Formula | C10H10BF3KNO |
| Molecular Weight | 267.10 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | potassium (4-cyano-2,6-dimethylphenoxy)methyl-trifluoroboranuide |
| SMILES | Cc1cc(C#N)cc(C)c1OC[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C10H10BF3NO.K/c1-7-3-9(5-15)4-8(2)10(7)16-6-11(12,13)14;/h3-4H,6H2,1-2H3;/q-1;+1 |
| InChIKey | IXQZIIAPWQVZHR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.10 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|