About 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile
4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile (PubChem CID 91583989) has the molecular formula C12H16N2OS
and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile |
| PubChem CID | 91583989 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1OCSN(C)C |
| InChI | InChI=1S/C12H16N2OS/c1-9-5-11(7-13)6-10(2)12(9)15-8-16-14(3)4/h5-6H,8H2,1-4H3 |
| InChIKey | XGLSFVAEGWVSEL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile?
The IUPAC name of 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile (CID 91583989) is 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C)c1OCSN(C)C.
What is the InChIKey of 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile?
The InChIKey is XGLSFVAEGWVSEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2OS/c1-9-5-11(7-13)6-10(2)12(9)15-8-16-14(3)4/h5-6H,8H2,1-4H3.
What are the key properties of 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile?
4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile has a molecular weight of 236.34 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylaminosulfanylmethoxy)-3,5-dimethylbenzonitrile is sourced from PubChem (CID 91583989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).