C15H21NO2 — CID 103867927
4-(6-hydroxyhexoxy)-3,5-dimethylbenzonitrile (PubChem CID 103867927) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-(6-hydroxyhexoxy)-3,5-dimethylbenzonitrile.
| Compound Name | 4-(6-hydroxyhexoxy)-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 103867927 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 4-(6-hydroxyhexoxy)-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1OCCCCCCO |
| InChI | InChI=1S/C15H21NO2/c1-12-9-14(11-16)10-13(2)15(12)18-8-6-4-3-5-7-17/h9-10,17H,3-8H2,1-2H3 |
| InChIKey | PEISAQKADPVXBR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|