5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride

C14H18ClNO3S — CID 65471384

IUPAC5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride
SMILESCc1cc(C#N)cc(C)c1OCCCCCS(=O)(=O)Cl
InChIInChI=1S/C14H18ClNO3S/c1-11-8-13(10-16)9-12(2)14(11)19-6-4-3-5-7-20(15,17)18/h8-9H,3-7H2,1-2H3
InChIKeyKKDWTYDAFNHWKF-UHFFFAOYSA-N
MW315.82 g/mol
LogP3.29
Rot. Bonds7

About 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride

5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride (PubChem CID 65471384) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride.

Molecular Properties

Compound Name5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride
PubChem CID65471384
Molecular FormulaC14H18ClNO3S
Molecular Weight315.82 g/mol
Exact Mass315.07
IUPAC Name5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride
SMILESCc1cc(C#N)cc(C)c1OCCCCCS(=O)(=O)Cl
InChIInChI=1S/C14H18ClNO3S/c1-11-8-13(10-16)9-12(2)14(11)19-6-4-3-5-7-20(15,17)18/h8-9H,3-7H2,1-2H3
InChIKeyKKDWTYDAFNHWKF-UHFFFAOYSA-N
XLogP3.29
TPSA67.16 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.82
LogP ≤ 53.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride?
The IUPAC name of 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride (CID 65471384) is 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride.
What is the SMILES notation for 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride?
The canonical SMILES for 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride is Cc1cc(C#N)cc(C)c1OCCCCCS(=O)(=O)Cl.
What is the InChIKey of 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride?
The InChIKey is KKDWTYDAFNHWKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO3S/c1-11-8-13(10-16)9-12(2)14(11)19-6-4-3-5-7-20(15,17)18/h8-9H,3-7H2,1-2H3.
What are the key properties of 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride?
5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride has a molecular weight of 315.82 g/mol, XLogP of 3.29, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride is sourced from PubChem (CID 65471384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).