C14H18ClNO3S — CID 65471384
5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride (PubChem CID 65471384) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride.
| Compound Name | 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 65471384 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-(4-cyano-2,6-dimethylphenoxy)pentane-1-sulfonyl chloride |
| SMILES | Cc1cc(C#N)cc(C)c1OCCCCCS(=O)(=O)Cl |
| InChI | InChI=1S/C14H18ClNO3S/c1-11-8-13(10-16)9-12(2)14(11)19-6-4-3-5-7-20(15,17)18/h8-9H,3-7H2,1-2H3 |
| InChIKey | KKDWTYDAFNHWKF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|