C12H13ClF4O3S — CID 103290434
6-(2,3,5,6-tetrafluorophenoxy)hexane-1-sulfonyl chloride (PubChem CID 103290434) has the molecular formula C12H13ClF4O3S and a molecular weight of 348.75 g/mol. Its IUPAC name is 6-(2,3,5,6-tetrafluorophenoxy)hexane-1-sulfonyl chloride.
| Compound Name | 6-(2,3,5,6-tetrafluorophenoxy)hexane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 103290434 |
| Molecular Formula | C12H13ClF4O3S |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 6-(2,3,5,6-tetrafluorophenoxy)hexane-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)CCCCCCOc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H13ClF4O3S/c13-21(18,19)6-4-2-1-3-5-20-12-10(16)8(14)7-9(15)11(12)17/h7H,1-6H2 |
| InChIKey | PVJFJTSOFDHZEP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|