C10H10F4O — CID 22416140
3-butoxy-1,2,4,5-tetrafluorobenzene (PubChem CID 22416140) has the molecular formula C10H10F4O and a molecular weight of 222.18 g/mol. Its IUPAC name is 3-butoxy-1,2,4,5-tetrafluorobenzene.
| Compound Name | 3-butoxy-1,2,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 22416140 |
| Molecular Formula | C10H10F4O |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-butoxy-1,2,4,5-tetrafluorobenzene |
| SMILES | CCCCOc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H10F4O/c1-2-3-4-15-10-8(13)6(11)5-7(12)9(10)14/h5H,2-4H2,1H3 |
| InChIKey | KQQGDVRFKWCJBR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|