C13H17F4NO2 — CID 103290316
3-ethoxy-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]propan-1-amine (PubChem CID 103290316) has the molecular formula C13H17F4NO2 and a molecular weight of 295.28 g/mol. Its IUPAC name is 3-ethoxy-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]propan-1-amine.
| Compound Name | 3-ethoxy-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103290316 |
| Molecular Formula | C13H17F4NO2 |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-ethoxy-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]propan-1-amine |
| SMILES | CCOCCCNCCOc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H17F4NO2/c1-2-19-6-3-4-18-5-7-20-13-11(16)9(14)8-10(15)12(13)17/h8,18H,2-7H2,1H3 |
| InChIKey | BDJRSHBDYDUMKV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|