C14H20Br3NO2 — CID 62572377
4-ethoxy-N-[2-(2,4,6-tribromophenoxy)ethyl]butan-1-amine (PubChem CID 62572377) has the molecular formula C14H20Br3NO2 and a molecular weight of 474.03 g/mol. Its IUPAC name is 4-ethoxy-N-[2-(2,4,6-tribromophenoxy)ethyl]butan-1-amine.
| Compound Name | 4-ethoxy-N-[2-(2,4,6-tribromophenoxy)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 62572377 |
| Molecular Formula | C14H20Br3NO2 |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 470.90 |
| IUPAC Name | 4-ethoxy-N-[2-(2,4,6-tribromophenoxy)ethyl]butan-1-amine |
| SMILES | CCOCCCCNCCOc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C14H20Br3NO2/c1-2-19-7-4-3-5-18-6-8-20-14-12(16)9-11(15)10-13(14)17/h9-10,18H,2-8H2,1H3 |
| InChIKey | YNDHEWKMSKDPIJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|