C15H23Br2NO2 — CID 63452839
2-butoxy-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]ethanamine (PubChem CID 63452839) has the molecular formula C15H23Br2NO2 and a molecular weight of 409.16 g/mol. Its IUPAC name is 2-butoxy-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]ethanamine.
| Compound Name | 2-butoxy-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 63452839 |
| Molecular Formula | C15H23Br2NO2 |
| Molecular Weight | 409.16 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 2-butoxy-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]ethanamine |
| SMILES | CCCCOCCNCc1cc(Br)cc(Br)c1OCC |
| InChI | InChI=1S/C15H23Br2NO2/c1-3-5-7-19-8-6-18-11-12-9-13(16)10-14(17)15(12)20-4-2/h9-10,18H,3-8,11H2,1-2H3 |
| InChIKey | IJPFCRPLQPQGNV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.16 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|