C13H19BrFNO — CID 61168889
N-[(5-bromo-2-fluorophenyl)methyl]-2-butoxyethanamine (PubChem CID 61168889) has the molecular formula C13H19BrFNO and a molecular weight of 304.20 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-2-butoxyethanamine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-2-butoxyethanamine |
|---|---|
| PubChem CID | 61168889 |
| Molecular Formula | C13H19BrFNO |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-2-butoxyethanamine |
| SMILES | CCCCOCCNCc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H19BrFNO/c1-2-3-7-17-8-6-16-10-11-9-12(14)4-5-13(11)15/h4-5,9,16H,2-3,6-8,10H2,1H3 |
| InChIKey | HGHGHXANPWDOSH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|