C12H15BrFNO — CID 28725705
N-[(5-bromo-2-fluorophenyl)methyl]-3-ethenoxypropan-1-amine (PubChem CID 28725705) has the molecular formula C12H15BrFNO and a molecular weight of 288.16 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-3-ethenoxypropan-1-amine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-ethenoxypropan-1-amine |
|---|---|
| PubChem CID | 28725705 |
| Molecular Formula | C12H15BrFNO |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-ethenoxypropan-1-amine |
| SMILES | C=COCCCNCc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H15BrFNO/c1-2-16-7-3-6-15-9-10-8-11(13)4-5-12(10)14/h2,4-5,8,15H,1,3,6-7,9H2 |
| InChIKey | KIGLZOJUDMMELU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|