C10H14BrFN2 — CID 101043657
N-[(5-bromo-2-fluorophenyl)methyl]-N',N'-dimethylmethanediamine (PubChem CID 101043657) has the molecular formula C10H14BrFN2 and a molecular weight of 261.14 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N',N'-dimethylmethanediamine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N',N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 101043657 |
| Molecular Formula | C10H14BrFN2 |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N',N'-dimethylmethanediamine |
| SMILES | CN(C)CNCc1cc(Br)ccc1F |
| InChI | InChI=1S/C10H14BrFN2/c1-14(2)7-13-6-8-5-9(11)3-4-10(8)12/h3-5,13H,6-7H2,1-2H3 |
| InChIKey | WEZNOBNABAGYIE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|