C12H17Br2NOS — CID 60658348
N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-2-methylsulfanylethanamine (PubChem CID 60658348) has the molecular formula C12H17Br2NOS and a molecular weight of 383.15 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-2-methylsulfanylethanamine.
| Compound Name | N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 60658348 |
| Molecular Formula | C12H17Br2NOS |
| Molecular Weight | 383.15 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-2-methylsulfanylethanamine |
| SMILES | CCOc1c(Br)cc(Br)cc1CNCCSC |
| InChI | InChI=1S/C12H17Br2NOS/c1-3-16-12-9(8-15-4-5-17-2)6-10(13)7-11(12)14/h6-7,15H,3-5,8H2,1-2H3 |
| InChIKey | SCLNQPKYFGXWFQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|