C16H23Br2NO2 — CID 106127186
4-[[(3,5-dibromo-2-ethoxyphenyl)methylamino]methyl]cyclohexan-1-ol (PubChem CID 106127186) has the molecular formula C16H23Br2NO2 and a molecular weight of 421.17 g/mol. Its IUPAC name is 4-[[(3,5-dibromo-2-ethoxyphenyl)methylamino]methyl]cyclohexan-1-ol.
| Compound Name | 4-[[(3,5-dibromo-2-ethoxyphenyl)methylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106127186 |
| Molecular Formula | C16H23Br2NO2 |
| Molecular Weight | 421.17 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 4-[[(3,5-dibromo-2-ethoxyphenyl)methylamino]methyl]cyclohexan-1-ol |
| SMILES | CCOc1c(Br)cc(Br)cc1CNCC1CCC(O)CC1 |
| InChI | InChI=1S/C16H23Br2NO2/c1-2-21-16-12(7-13(17)8-15(16)18)10-19-9-11-3-5-14(20)6-4-11/h7-8,11,14,19-20H,2-6,9-10H2,1H3 |
| InChIKey | WGXVBZPBZNBVKK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.17 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |