C10H13Br2NO — CID 4717481
1-(3,5-dibromo-2-ethoxyphenyl)-N-methylmethanamine (PubChem CID 4717481) has the molecular formula C10H13Br2NO and a molecular weight of 323.03 g/mol. Its IUPAC name is 1-(3,5-dibromo-2-ethoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(3,5-dibromo-2-ethoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 4717481 |
| Molecular Formula | C10H13Br2NO |
| Molecular Weight | 323.03 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | 1-(3,5-dibromo-2-ethoxyphenyl)-N-methylmethanamine |
| SMILES | CCOc1c(Br)cc(Br)cc1CNC |
| InChI | InChI=1S/C10H13Br2NO/c1-3-14-10-7(6-13-2)4-8(11)5-9(10)12/h4-5,13H,3,6H2,1-2H3 |
| InChIKey | ABRAIWMNCSTNDT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.03 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |