C12H15Br2NO3 — CID 54959237
2-[(3,5-dibromo-2-ethoxyphenyl)methylamino]propanoic acid (PubChem CID 54959237) has the molecular formula C12H15Br2NO3 and a molecular weight of 381.06 g/mol. Its IUPAC name is 2-[(3,5-dibromo-2-ethoxyphenyl)methylamino]propanoic acid.
| Compound Name | 2-[(3,5-dibromo-2-ethoxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 54959237 |
| Molecular Formula | C12H15Br2NO3 |
| Molecular Weight | 381.06 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | 2-[(3,5-dibromo-2-ethoxyphenyl)methylamino]propanoic acid |
| SMILES | CCOc1c(Br)cc(Br)cc1CNC(C)C(=O)O |
| InChI | InChI=1S/C12H15Br2NO3/c1-3-18-11-8(4-9(13)5-10(11)14)6-15-7(2)12(16)17/h4-5,7,15H,3,6H2,1-2H3,(H,16,17) |
| InChIKey | JJOOKHSEJYIMEF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.06 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |