C15H13Br4NO — CID 107597573
2,6-dibromo-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]aniline (PubChem CID 107597573) has the molecular formula C15H13Br4NO and a molecular weight of 542.89 g/mol. Its IUPAC name is 2,6-dibromo-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]aniline.
| Compound Name | 2,6-dibromo-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 107597573 |
| Molecular Formula | C15H13Br4NO |
| Molecular Weight | 542.89 g/mol |
| Exact Mass | 538.77 |
| IUPAC Name | 2,6-dibromo-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]aniline |
| SMILES | CCOc1c(Br)cc(Br)cc1CNc1c(Br)cccc1Br |
| InChI | InChI=1S/C15H13Br4NO/c1-2-21-15-9(6-10(16)7-13(15)19)8-20-14-11(17)4-3-5-12(14)18/h3-7,20H,2,8H2,1H3 |
| InChIKey | ALGAMJPWJGXHEX-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.89 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |