C16H17Br2NO — CID 43766092
N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-2-methylaniline (PubChem CID 43766092) has the molecular formula C16H17Br2NO and a molecular weight of 399.13 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-2-methylaniline.
| Compound Name | N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 43766092 |
| Molecular Formula | C16H17Br2NO |
| Molecular Weight | 399.13 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-2-methylaniline |
| SMILES | CCOc1c(Br)cc(Br)cc1CNc1ccccc1C |
| InChI | InChI=1S/C16H17Br2NO/c1-3-20-16-12(8-13(17)9-14(16)18)10-19-15-7-5-4-6-11(15)2/h4-9,19H,3,10H2,1-2H3 |
| InChIKey | ONHHHNJPTKWIJV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.13 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |