C18H21Br2NO — CID 126126469
N-[(3,5-dibromo-2-propoxyphenyl)methyl]-2,3-dimethylaniline (PubChem CID 126126469) has the molecular formula C18H21Br2NO and a molecular weight of 427.18 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-propoxyphenyl)methyl]-2,3-dimethylaniline.
| Compound Name | N-[(3,5-dibromo-2-propoxyphenyl)methyl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 126126469 |
| Molecular Formula | C18H21Br2NO |
| Molecular Weight | 427.18 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | N-[(3,5-dibromo-2-propoxyphenyl)methyl]-2,3-dimethylaniline |
| SMILES | CCCOc1c(Br)cc(Br)cc1CNc1cccc(C)c1C |
| InChI | InChI=1S/C18H21Br2NO/c1-4-8-22-18-14(9-15(19)10-16(18)20)11-21-17-7-5-6-12(2)13(17)3/h5-7,9-10,21H,4,8,11H2,1-3H3 |
| InChIKey | RZMPPOUWBZJTGJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.18 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |