C18H17Br2NO — CID 126122897
N-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methyl]-2,3-dimethylaniline (PubChem CID 126122897) has the molecular formula C18H17Br2NO and a molecular weight of 423.15 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methyl]-2,3-dimethylaniline.
| Compound Name | N-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methyl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 126122897 |
| Molecular Formula | C18H17Br2NO |
| Molecular Weight | 423.15 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | N-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methyl]-2,3-dimethylaniline |
| SMILES | C#CCOc1c(Br)cc(CNc2cccc(C)c2C)cc1Br |
| InChI | InChI=1S/C18H17Br2NO/c1-4-8-22-18-15(19)9-14(10-16(18)20)11-21-17-7-5-6-12(2)13(17)3/h1,5-7,9-10,21H,8,11H2,2-3H3 |
| InChIKey | PSTUFMPBHPVNCH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.15 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|