C22H21Br2NO — CID 126123491
N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2,3-dimethylaniline (PubChem CID 126123491) has the molecular formula C22H21Br2NO and a molecular weight of 475.22 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2,3-dimethylaniline.
| Compound Name | N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 126123491 |
| Molecular Formula | C22H21Br2NO |
| Molecular Weight | 475.22 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2,3-dimethylaniline |
| SMILES | Cc1cccc(NCc2cc(Br)c(OCc3ccccc3)c(Br)c2)c1C |
| InChI | InChI=1S/C22H21Br2NO/c1-15-7-6-10-21(16(15)2)25-13-18-11-19(23)22(20(24)12-18)26-14-17-8-4-3-5-9-17/h3-12,25H,13-14H2,1-2H3 |
| InChIKey | NPTPMJRPXIIYAK-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.22 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |