C22H21Br2NO — CID 126122856
N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2-ethylaniline (PubChem CID 126122856) has the molecular formula C22H21Br2NO and a molecular weight of 475.22 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2-ethylaniline.
| Compound Name | N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2-ethylaniline |
|---|---|
| PubChem CID | 126122856 |
| Molecular Formula | C22H21Br2NO |
| Molecular Weight | 475.22 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2-ethylaniline |
| SMILES | CCc1ccccc1NCc1cc(Br)c(OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C22H21Br2NO/c1-2-18-10-6-7-11-21(18)25-14-17-12-19(23)22(20(24)13-17)26-15-16-8-4-3-5-9-16/h3-13,25H,2,14-15H2,1H3 |
| InChIKey | VKZUQJQIGHMWMX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.22 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |