C23H22BrNO4 — CID 17059056
3-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]-2-methylbenzoic acid (PubChem CID 17059056) has the molecular formula C23H22BrNO4 and a molecular weight of 456.34 g/mol. Its IUPAC name is 3-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]-2-methylbenzoic acid.
| Compound Name | 3-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 17059056 |
| Molecular Formula | C23H22BrNO4 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 3-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylamino]-2-methylbenzoic acid |
| SMILES | COc1cc(CNc2cccc(C(=O)O)c2C)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H22BrNO4/c1-15-18(23(26)27)9-6-10-20(15)25-13-17-11-19(24)22(21(12-17)28-2)29-14-16-7-4-3-5-8-16/h3-12,25H,13-14H2,1-2H3,(H,26,27) |
| InChIKey | WYOKVYYLHPFNMS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |