C24H24BrNO4 — CID 66543878
3-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid (PubChem CID 66543878) has the molecular formula C24H24BrNO4 and a molecular weight of 470.36 g/mol. Its IUPAC name is 3-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid.
| Compound Name | 3-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 66543878 |
| Molecular Formula | C24H24BrNO4 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 3-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid |
| SMILES | COc1ccc(Br)c(CNc2cccc(C(=O)O)c2C)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H24BrNO4/c1-15-7-9-17(10-8-15)14-30-23-19(20(25)11-12-22(23)29-3)13-26-21-6-4-5-18(16(21)2)24(27)28/h4-12,26H,13-14H2,1-3H3,(H,27,28) |
| InChIKey | XNXBVWBSRYNXTG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |