C23H22BrNO3 — CID 17058270
3-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid (PubChem CID 17058270) has the molecular formula C23H22BrNO3 and a molecular weight of 440.34 g/mol. Its IUPAC name is 3-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid.
| Compound Name | 3-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 17058270 |
| Molecular Formula | C23H22BrNO3 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 3-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid |
| SMILES | Cc1ccc(COc2ccc(Br)cc2CNc2cccc(C(=O)O)c2C)cc1 |
| InChI | InChI=1S/C23H22BrNO3/c1-15-6-8-17(9-7-15)14-28-22-11-10-19(24)12-18(22)13-25-21-5-3-4-20(16(21)2)23(26)27/h3-12,25H,13-14H2,1-2H3,(H,26,27) |
| InChIKey | RJIPHZRCQCRXOD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |