C22H20FNO3 — CID 17059349
3-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid (PubChem CID 17059349) has the molecular formula C22H20FNO3 and a molecular weight of 365.40 g/mol. Its IUPAC name is 3-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid.
| Compound Name | 3-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 17059349 |
| Molecular Formula | C22H20FNO3 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]-2-methylbenzoic acid |
| SMILES | Cc1c(NCc2cccc(OCc3ccc(F)cc3)c2)cccc1C(=O)O |
| InChI | InChI=1S/C22H20FNO3/c1-15-20(22(25)26)6-3-7-21(15)24-13-17-4-2-5-19(12-17)27-14-16-8-10-18(23)11-9-16/h2-12,24H,13-14H2,1H3,(H,25,26) |
| InChIKey | CWLBPOVGZYADOU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |