C24H25NO5 — CID 17058758
4-methoxy-3-[[3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]benzoic acid (PubChem CID 17058758) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-methoxy-3-[[3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]benzoic acid.
| Compound Name | 4-methoxy-3-[[3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 17058758 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-methoxy-3-[[3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NCc1cccc(OC)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H25NO5/c1-16-7-9-17(10-8-16)15-30-23-19(5-4-6-22(23)29-3)14-25-20-13-18(24(26)27)11-12-21(20)28-2/h4-13,25H,14-15H2,1-3H3,(H,26,27) |
| InChIKey | XERZOPYOQRWOER-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |