C22H20FNO4 — CID 17059187
3-[[2-[(2-fluorophenyl)methoxy]phenyl]methylamino]-4-methoxybenzoic acid (PubChem CID 17059187) has the molecular formula C22H20FNO4 and a molecular weight of 381.40 g/mol. Its IUPAC name is 3-[[2-[(2-fluorophenyl)methoxy]phenyl]methylamino]-4-methoxybenzoic acid.
| Compound Name | 3-[[2-[(2-fluorophenyl)methoxy]phenyl]methylamino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 17059187 |
| Molecular Formula | C22H20FNO4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 3-[[2-[(2-fluorophenyl)methoxy]phenyl]methylamino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NCc1ccccc1OCc1ccccc1F |
| InChI | InChI=1S/C22H20FNO4/c1-27-21-11-10-15(22(25)26)12-19(21)24-13-16-6-3-5-9-20(16)28-14-17-7-2-4-8-18(17)23/h2-12,24H,13-14H2,1H3,(H,25,26) |
| InChIKey | HGVUPDMZAKZDTF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |