C23H23NO3 — CID 126124769
4-[[2-[(2,4-dimethylanilino)methyl]phenoxy]methyl]benzoic acid (PubChem CID 126124769) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-[[2-[(2,4-dimethylanilino)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(2,4-dimethylanilino)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126124769 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 4-[[2-[(2,4-dimethylanilino)methyl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1ccc(NCc2ccccc2OCc2ccc(C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C23H23NO3/c1-16-7-12-21(17(2)13-16)24-14-20-5-3-4-6-22(20)27-15-18-8-10-19(11-9-18)23(25)26/h3-13,24H,14-15H2,1-2H3,(H,25,26) |
| InChIKey | QGUGIWQTVDMEGV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |