C20H16Br2ClNO — CID 3974934
3-chloro-N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]aniline (PubChem CID 3974934) has the molecular formula C20H16Br2ClNO and a molecular weight of 481.62 g/mol. Its IUPAC name is 3-chloro-N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]aniline.
| Compound Name | 3-chloro-N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 3974934 |
| Molecular Formula | C20H16Br2ClNO |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 478.93 |
| IUPAC Name | 3-chloro-N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]aniline |
| SMILES | Clc1cccc(NCc2cc(Br)c(OCc3ccccc3)c(Br)c2)c1 |
| InChI | InChI=1S/C20H16Br2ClNO/c21-18-9-15(12-24-17-8-4-7-16(23)11-17)10-19(22)20(18)25-13-14-5-2-1-3-6-14/h1-11,24H,12-13H2 |
| InChIKey | ISQZZRXKDKLLQF-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |