C21H18BrClINO2 — CID 126373473
N-[[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-3-chloroaniline (PubChem CID 126373473) has the molecular formula C21H18BrClINO2 and a molecular weight of 558.64 g/mol. Its IUPAC name is N-[[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-3-chloroaniline.
| Compound Name | N-[[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-3-chloroaniline |
|---|---|
| PubChem CID | 126373473 |
| Molecular Formula | C21H18BrClINO2 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 556.93 |
| IUPAC Name | N-[[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-3-chloroaniline |
| SMILES | COc1cc(CNc2cccc(Cl)c2)cc(I)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H18BrClINO2/c1-26-20-10-15(12-25-18-4-2-3-17(23)11-18)9-19(24)21(20)27-13-14-5-7-16(22)8-6-14/h2-11,25H,12-13H2,1H3 |
| InChIKey | OQODQNOSSFSWKP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|